C10H23NO2Si — CID 171692296
3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-amine (PubChem CID 171692296) has the molecular formula C10H23NO2Si and a molecular weight of 217.38 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-amine.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-amine |
|---|---|
| PubChem CID | 171692296 |
| Molecular Formula | C10H23NO2Si |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(N)COC1 |
| InChI | InChI=1S/C10H23NO2Si/c1-9(2,3)14(4,5)13-8-10(11)6-12-7-10/h6-8,11H2,1-5H3 |
| InChIKey | HUMUHCLMDYHVIN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|