C13H27BrO2Si — CID 11336259
[(2S,3R,4S)-3-bromo-2,4-dimethyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11336259) has the molecular formula C13H27BrO2Si and a molecular weight of 323.35 g/mol. Its IUPAC name is [(2S,3R,4S)-3-bromo-2,4-dimethyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R,4S)-3-bromo-2,4-dimethyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11336259 |
| Molecular Formula | C13H27BrO2Si |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [(2S,3R,4S)-3-bromo-2,4-dimethyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H]1CO[C@@](C)(CO[Si](C)(C)C(C)(C)C)[C@@H]1Br |
| InChI | InChI=1S/C13H27BrO2Si/c1-10-8-15-13(5,11(10)14)9-16-17(6,7)12(2,3)4/h10-11H,8-9H2,1-7H3/t10-,11+,13-/m0/s1 |
| InChIKey | LOXBUYQNNPFVOM-LOWVWBTDSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|