C16H32O3Si — CID 135068634
(3R,3aS,6R,6aR)-6a-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethyl-3,3a,4,5-tetrahydro-2H-cyclopenta[b]furan-6-ol (PubChem CID 135068634) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is (3R,3aS,6R,6aR)-6a-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethyl-3,3a,4,5-tetrahydro-2H-cyclopenta[b]furan-6-ol.
| Compound Name | (3R,3aS,6R,6aR)-6a-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethyl-3,3a,4,5-tetrahydro-2H-cyclopenta[b]furan-6-ol |
|---|---|
| PubChem CID | 135068634 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (3R,3aS,6R,6aR)-6a-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethyl-3,3a,4,5-tetrahydro-2H-cyclopenta[b]furan-6-ol |
| SMILES | C[C@H]1CO[C@@]2(CO[Si](C)(C)C(C)(C)C)[C@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C16H32O3Si/c1-12-10-18-16(13(12)8-9-15(16,5)17)11-19-20(6,7)14(2,3)4/h12-13,17H,8-11H2,1-7H3/t12-,13-,15+,16-/m0/s1 |
| InChIKey | MARASDJCUWEEJU-UGQVUOCMSA-N |
| XLogP | 3.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|