C12H26O3Si — CID 53497048
(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclopentane-1,2-diol (PubChem CID 53497048) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 53497048 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclopentane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C12H26O3Si/c1-11(2,3)16(5,6)15-9-7-8-12(4,14)10(9)13/h9-10,13-14H,7-8H2,1-6H3/t9-,10-,12+/m0/s1 |
| InChIKey | SYRLLUSEJJLTDY-JBLDHEPKSA-N |
| XLogP | 2.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|