C14H28O3Si — CID 89472494
(1R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-4-methylidenecyclohexane-1,3-diol (PubChem CID 89472494) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is (1R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-4-methylidenecyclohexane-1,3-diol.
| Compound Name | (1R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 89472494 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (1R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-methyl-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)C[C@@](C)(O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-10-11(15)8-14(5,16)9-12(10)17-18(6,7)13(2,3)4/h11-12,15-16H,1,8-9H2,2-7H3/t11-,12-,14-/m1/s1 |
| InChIKey | HORDOYYQVAROMZ-YRGRVCCFSA-N |
| XLogP | 2.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|