C21H42O5Si2 — CID 91867254
cis-methyl (3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4-methylidenecyclohexane-1-carboxylate (PubChem CID 91867254) has the molecular formula C21H42O5Si2 and a molecular weight of 430.73 g/mol. Its IUPAC name is cis-methyl (3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4-methylidenecyclohexane-1-carboxylate.
| Compound Name | cis-methyl (3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4-methylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91867254 |
| Molecular Formula | C21H42O5Si2 |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | cis-methyl (3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-hydroxy-4-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)OC)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O5Si2/c1-15-16(25-27(9,10)19(2,3)4)13-21(23,18(22)24-8)14-17(15)26-28(11,12)20(5,6)7/h16-17,23H,1,13-14H2,2-12H3/t16-,17+,21? |
| InChIKey | UJTXGXRUTHUTDR-QRTHJKPMSA-N |
| XLogP | 5.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|