C14H26O4Si — CID 102350607
(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(deuteriomethyl)-1-hydroxycyclohex-3-ene-1-carboxylic acid (PubChem CID 102350607) has the molecular formula C14H26O4Si and a molecular weight of 287.45 g/mol. Its IUPAC name is (1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(deuteriomethyl)-1-hydroxycyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(deuteriomethyl)-1-hydroxycyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 102350607 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(deuteriomethyl)-1-hydroxycyclohex-3-ene-1-carboxylic acid |
| SMILES | [2H]CC1=CC[C@](O)(C(=O)O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-10-7-8-14(17,12(15)16)9-11(10)18-19(5,6)13(2,3)4/h7,11,17H,8-9H2,1-6H3,(H,15,16)/t11-,14-/m1/s1/i1D |
| InChIKey | PXYKOQCDUGMHAS-BBQDGRSOSA-N |
| XLogP | 2.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|