C13H25BrOSi — CID 99772598
[(1S)-2-bromo-4,4-dimethylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 99772598) has the molecular formula C13H25BrOSi and a molecular weight of 305.33 g/mol. Its IUPAC name is [(1S)-2-bromo-4,4-dimethylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-2-bromo-4,4-dimethylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 99772598 |
| Molecular Formula | C13H25BrOSi |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [(1S)-2-bromo-4,4-dimethylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)C=C(Br)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H25BrOSi/c1-12(2,3)16(6,7)15-11-9-13(4,5)8-10(11)14/h8,11H,9H2,1-7H3/t11-/m0/s1 |
| InChIKey | YSHXRTQKXFMIKF-NSHDSACASA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|