C15H22O3Si — CID 162711473
3-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydrochromen-2-one (PubChem CID 162711473) has the molecular formula C15H22O3Si and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydrochromen-2-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 162711473 |
| Molecular Formula | C15H22O3Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydrochromen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1Cc2ccccc2OC1=O |
| InChI | InChI=1S/C15H22O3Si/c1-15(2,3)19(4,5)18-13-10-11-8-6-7-9-12(11)17-14(13)16/h6-9,13H,10H2,1-5H3 |
| InChIKey | LBOYFXXZGLDUBN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|