C23H36O3Si — CID 56603590
trans-(9R,11R)-9-[tert-butyl(dimethyl)silyl]oxy-8-methylidene-11-phenyl-oxacycloundecan-2-one (PubChem CID 56603590) has the molecular formula C23H36O3Si and a molecular weight of 388.62 g/mol. Its IUPAC name is trans-(9R,11R)-9-[tert-butyl(dimethyl)silyl]oxy-8-methylidene-11-phenyl-oxacycloundecan-2-one.
| Compound Name | trans-(9R,11R)-9-[tert-butyl(dimethyl)silyl]oxy-8-methylidene-11-phenyl-oxacycloundecan-2-one |
|---|---|
| PubChem CID | 56603590 |
| Molecular Formula | C23H36O3Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | trans-(9R,11R)-9-[tert-butyl(dimethyl)silyl]oxy-8-methylidene-11-phenyl-oxacycloundecan-2-one |
| SMILES | C=C1CCCCCC(=O)O[C@@H](c2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H36O3Si/c1-18-13-9-7-12-16-22(24)25-21(19-14-10-8-11-15-19)17-20(18)26-27(5,6)23(2,3)4/h8,10-11,14-15,20-21H,1,7,9,12-13,16-17H2,2-6H3/t20-,21-/m1/s1 |
| InChIKey | ZLQSALMXEHJQSW-NHCUHLMSSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|