C13H26O2Si — CID 14396580
2-[tert-butyl(dimethyl)silyl]oxycycloheptan-1-one (PubChem CID 14396580) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxycycloheptan-1-one.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxycycloheptan-1-one |
|---|---|
| PubChem CID | 14396580 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxycycloheptan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCCCC1=O |
| InChI | InChI=1S/C13H26O2Si/c1-13(2,3)16(4,5)15-12-10-8-6-7-9-11(12)14/h12H,6-10H2,1-5H3 |
| InChIKey | JRLXHGYNQJVQKL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|