C18H36OSi2 — CID 51349898
tert-butyl-dimethyl-[2-(2-trimethylsilylethenylidene)cycloheptyl]oxysilane (PubChem CID 51349898) has the molecular formula C18H36OSi2 and a molecular weight of 324.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-(2-trimethylsilylethenylidene)cycloheptyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[2-(2-trimethylsilylethenylidene)cycloheptyl]oxysilane |
|---|---|
| PubChem CID | 51349898 |
| Molecular Formula | C18H36OSi2 |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | tert-butyl-dimethyl-[2-(2-trimethylsilylethenylidene)cycloheptyl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCCCC1=C=C[Si](C)(C)C |
| InChI | InChI=1S/C18H36OSi2/c1-18(2,3)21(7,8)19-17-13-11-9-10-12-16(17)14-15-20(4,5)6/h15,17H,9-13H2,1-8H3 |
| InChIKey | TTZWEFXEIKTKJV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|