C18H32O4Si — CID 134831896
(3E,6S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-methyl-1-oxacyclododec-3-ene-2,5-dione (PubChem CID 134831896) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (3E,6S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-methyl-1-oxacyclododec-3-ene-2,5-dione.
| Compound Name | (3E,6S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-methyl-1-oxacyclododec-3-ene-2,5-dione |
|---|---|
| PubChem CID | 134831896 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (3E,6S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-methyl-1-oxacyclododec-3-ene-2,5-dione |
| SMILES | C[C@@H]1CCCCC[C@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C18H32O4Si/c1-14-10-8-7-9-11-16(15(19)12-13-17(20)21-14)22-23(5,6)18(2,3)4/h12-14,16H,7-11H2,1-6H3/b13-12+/t14-,16+/m1/s1 |
| InChIKey | VBWNDHIDCUGNNL-JIXSRCLSSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|