C22H40O4Si — CID 15737219
(1S,2Z,6R,15S,16R)-15-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5,17-dioxabicyclo[14.1.0]heptadec-2-en-4-one (PubChem CID 15737219) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is (1S,2Z,6R,15S,16R)-15-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5,17-dioxabicyclo[14.1.0]heptadec-2-en-4-one.
| Compound Name | (1S,2Z,6R,15S,16R)-15-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5,17-dioxabicyclo[14.1.0]heptadec-2-en-4-one |
|---|---|
| PubChem CID | 15737219 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (1S,2Z,6R,15S,16R)-15-[tert-butyl(dimethyl)silyl]oxy-6-methyl-5,17-dioxabicyclo[14.1.0]heptadec-2-en-4-one |
| SMILES | C[C@@H]1CCCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@H]2/C=C\C(=O)O1 |
| InChI | InChI=1S/C22H40O4Si/c1-17-13-11-9-7-8-10-12-14-19(26-27(5,6)22(2,3)4)21-18(25-21)15-16-20(23)24-17/h15-19,21H,7-14H2,1-6H3/b16-15-/t17-,18+,19+,21-/m1/s1 |
| InChIKey | JGJZASWIPAVXSF-GWENYHFKSA-N |
| XLogP | 5.77 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|