C15H25IO2Si — CID 12013199
(4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 12013199) has the molecular formula C15H25IO2Si and a molecular weight of 392.35 g/mol. Its IUPAC name is (4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 12013199 |
| Molecular Formula | C15H25IO2Si |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodo-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@H]2CC(=O)C(I)=C21 |
| InChI | InChI=1S/C15H25IO2Si/c1-15(2,3)19(4,5)18-12-8-6-7-10-9-11(17)14(16)13(10)12/h10,12H,6-9H2,1-5H3/t10-,12+/m0/s1 |
| InChIKey | QLBQLTDLRKYHPI-CMPLNLGQSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|