C18H34GeO2Si — CID 12013197
(4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylgermyl-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 12013197) has the molecular formula C18H34GeO2Si and a molecular weight of 383.16 g/mol. Its IUPAC name is (4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylgermyl-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylgermyl-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 12013197 |
| Molecular Formula | C18H34GeO2Si |
| Molecular Weight | 383.16 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-trimethylgermyl-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@H]2CC(=O)C([Ge](C)(C)C)=C21 |
| InChI | InChI=1S/C18H34GeO2Si/c1-18(2,3)22(7,8)21-15-11-9-10-13-12-14(20)17(16(13)15)19(4,5)6/h13,15H,9-12H2,1-8H3/t13-,15+/m0/s1 |
| InChIKey | MVQNWPPZMKMHCU-DZGCQCFKSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.16 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|