C20H36O3Si — CID 10570034
9-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-2,3,3a,6,7,8,9,10a-octahydro-1H-cyclopenta[9]annulene-5,10-dione (PubChem CID 10570034) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is 9-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-2,3,3a,6,7,8,9,10a-octahydro-1H-cyclopenta[9]annulene-5,10-dione.
| Compound Name | 9-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-2,3,3a,6,7,8,9,10a-octahydro-1H-cyclopenta[9]annulene-5,10-dione |
|---|---|
| PubChem CID | 10570034 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 9-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyl-2,3,3a,6,7,8,9,10a-octahydro-1H-cyclopenta[9]annulene-5,10-dione |
| SMILES | CC1(C)C(=O)CCCC(O[Si](C)(C)C(C)(C)C)C(=O)C2CCCC21 |
| InChI | InChI=1S/C20H36O3Si/c1-19(2,3)24(6,7)23-16-12-9-13-17(21)20(4,5)15-11-8-10-14(15)18(16)22/h14-16H,8-13H2,1-7H3 |
| InChIKey | HMINKNQNSLBLCJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|