C16H32N2O2Si2 — CID 102133173
(3aS,6S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyl-1,3a,4,5,6,7a-hexahydroindazol-7-one (PubChem CID 102133173) has the molecular formula C16H32N2O2Si2 and a molecular weight of 340.62 g/mol. Its IUPAC name is (3aS,6S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyl-1,3a,4,5,6,7a-hexahydroindazol-7-one.
| Compound Name | (3aS,6S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyl-1,3a,4,5,6,7a-hexahydroindazol-7-one |
|---|---|
| PubChem CID | 102133173 |
| Molecular Formula | C16H32N2O2Si2 |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (3aS,6S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyl-1,3a,4,5,6,7a-hexahydroindazol-7-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@H]2C([Si](C)(C)C)=NN[C@H]2C1=O |
| InChI | InChI=1S/C16H32N2O2Si2/c1-16(2,3)22(7,8)20-12-10-9-11-13(14(12)19)17-18-15(11)21(4,5)6/h11-13,17H,9-10H2,1-8H3/t11-,12-,13+/m0/s1 |
| InChIKey | UYTGEIWUPZCQTP-RWMBFGLXSA-N |
| XLogP | 3.56 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|