C11H20O3Si — CID 14070870
4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxycyclopent-2-en-1-one (PubChem CID 14070870) has the molecular formula C11H20O3Si and a molecular weight of 228.36 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxycyclopent-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 14070870 |
| Molecular Formula | C11H20O3Si |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxycyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(=O)C=C1O |
| InChI | InChI=1S/C11H20O3Si/c1-11(2,3)15(4,5)14-10-7-8(12)6-9(10)13/h6,10,13H,7H2,1-5H3 |
| InChIKey | LDUSTRNNJBHFIL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|