C11H19BrO2Si — CID 10708674
(4S)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one (PubChem CID 10708674) has the molecular formula C11H19BrO2Si and a molecular weight of 291.26 g/mol. Its IUPAC name is (4S)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one.
| Compound Name | (4S)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10708674 |
| Molecular Formula | C11H19BrO2Si |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (4S)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C(Br)C(=O)C1 |
| InChI | InChI=1S/C11H19BrO2Si/c1-11(2,3)15(4,5)14-8-6-9(12)10(13)7-8/h6,8H,7H2,1-5H3/t8-/m1/s1 |
| InChIKey | PIIFULRVBPPSJP-MRVPVSSYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|