C18H36NO2Si+ — CID 58637017
[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]methyl-triethylazanium (PubChem CID 58637017) has the molecular formula C18H36NO2Si+ and a molecular weight of 326.58 g/mol. Its IUPAC name is [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]methyl-triethylazanium.
| Compound Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]methyl-triethylazanium |
|---|---|
| PubChem CID | 58637017 |
| Molecular Formula | C18H36NO2Si+ |
| Molecular Weight | 326.58 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | [(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]methyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C18H36NO2Si/c1-9-19(10-2,11-3)14-15-12-16(13-17(15)20)21-22(7,8)18(4,5)6/h12,16H,9-11,13-14H2,1-8H3/q+1/t16-/m1/s1 |
| InChIKey | GJOYRQSQPOFSNF-MRXNPFEDSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|