C23H36N2O4SSi — CID 168967937
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[[(2R)-2-(4-methylphenyl)sulfonylbutyl]diazenyl]methyl]cyclopent-2-en-1-one (PubChem CID 168967937) has the molecular formula C23H36N2O4SSi and a molecular weight of 464.70 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[[(2R)-2-(4-methylphenyl)sulfonylbutyl]diazenyl]methyl]cyclopent-2-en-1-one.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[[(2R)-2-(4-methylphenyl)sulfonylbutyl]diazenyl]methyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 168967937 |
| Molecular Formula | C23H36N2O4SSi |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[[(2R)-2-(4-methylphenyl)sulfonylbutyl]diazenyl]methyl]cyclopent-2-en-1-one |
| SMILES | CC[C@H](C/N=N/CC1=C[C@H](O[Si](C)(C)C(C)(C)C)CC1=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H36N2O4SSi/c1-8-20(30(27,28)21-11-9-17(2)10-12-21)16-25-24-15-18-13-19(14-22(18)26)29-31(6,7)23(3,4)5/h9-13,19-20H,8,14-16H2,1-7H3/b25-24+/t19-,20+/m0/s1 |
| InChIKey | CERYUVVMHHIPQT-QQIVJABXSA-N |
| XLogP | 5.29 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|