C17H22N2O4S — CID 168967940
4-hydroxy-2-[[2-(4-methylphenyl)sulfonylbutyldiazenyl]methyl]cyclopent-2-en-1-one (PubChem CID 168967940) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-hydroxy-2-[[2-(4-methylphenyl)sulfonylbutyldiazenyl]methyl]cyclopent-2-en-1-one.
| Compound Name | 4-hydroxy-2-[[2-(4-methylphenyl)sulfonylbutyldiazenyl]methyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 168967940 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4-hydroxy-2-[[2-(4-methylphenyl)sulfonylbutyldiazenyl]methyl]cyclopent-2-en-1-one |
| SMILES | CCC(C/N=N/CC1=CC(O)CC1=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-3-15(24(22,23)16-6-4-12(2)5-7-16)11-19-18-10-13-8-14(20)9-17(13)21/h4-8,14-15,20H,3,9-11H2,1-2H3/b19-18+ |
| InChIKey | FMOQLUDYIXFHQV-VHEBQXMUSA-N |
| XLogP | 2.26 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|