C12H13NO2S — CID 98229937
1-[(R)-cyclopropyl(isocyano)methyl]sulfonyl-4-methylbenzene (PubChem CID 98229937) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-[(R)-cyclopropyl(isocyano)methyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[(R)-cyclopropyl(isocyano)methyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 98229937 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-[(R)-cyclopropyl(isocyano)methyl]sulfonyl-4-methylbenzene |
| SMILES | [C-]#[N+][C@@H](C1CC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H13NO2S/c1-9-3-7-11(8-4-9)16(14,15)12(13-2)10-5-6-10/h3-4,7-8,10,12H,5-6H2,1H3/t12-/m1/s1 |
| InChIKey | ZRFHBJIXRUHQII-GFCCVEGCSA-N |
| XLogP | 2.42 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|