C12H16O2S — CID 135078085
1-(1-cyclopropylethylsulfonyl)-4-methylbenzene (PubChem CID 135078085) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is 1-(1-cyclopropylethylsulfonyl)-4-methylbenzene.
| Compound Name | 1-(1-cyclopropylethylsulfonyl)-4-methylbenzene |
|---|---|
| PubChem CID | 135078085 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1-(1-cyclopropylethylsulfonyl)-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C(C)C2CC2)cc1 |
| InChI | InChI=1S/C12H16O2S/c1-9-3-7-12(8-4-9)15(13,14)10(2)11-5-6-11/h3-4,7-8,10-11H,5-6H2,1-2H3 |
| InChIKey | NKWBVCIOZALHOB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |