C7H9O2SSi — CID 173032545
CID 173032545 (PubChem CID 173032545) has the molecular formula C7H9O2SSi and a molecular weight of 185.30 g/mol.
| Compound Name | CID 173032545 |
|---|---|
| PubChem CID | 173032545 |
| Molecular Formula | C7H9O2SSi |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)[SiH2])cc1 |
| InChI | InChI=1S/C7H9O2SSi/c1-6-2-4-7(5-3-6)10(8,9)11/h2-5H,11H2,1H3 |
| InChIKey | VDSYBUXNVKUIOT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|