C14H15NOS — CID 54310635
imino-bis(4-methylphenyl)-oxo-λ6-sulfane (PubChem CID 54310635) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is imino-bis(4-methylphenyl)-oxo-λ6-sulfane.
| Compound Name | imino-bis(4-methylphenyl)-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 54310635 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | imino-bis(4-methylphenyl)-oxo-λ6-sulfane |
| SMILES | [H]N=S(=O)(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H15NOS/c1-11-3-7-13(8-4-11)17(15,16)14-9-5-12(2)6-10-14/h3-10,15H,1-2H3 |
| InChIKey | SKPWJLQVXAFKKH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |