C16H22O5S — CID 10616125
(1S)-5,5-diethoxy-3-(4-methylphenyl)sulfonylcyclopent-2-en-1-ol (PubChem CID 10616125) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is (1S)-5,5-diethoxy-3-(4-methylphenyl)sulfonylcyclopent-2-en-1-ol.
| Compound Name | (1S)-5,5-diethoxy-3-(4-methylphenyl)sulfonylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10616125 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (1S)-5,5-diethoxy-3-(4-methylphenyl)sulfonylcyclopent-2-en-1-ol |
| SMILES | CCOC1(OCC)CC(S(=O)(=O)c2ccc(C)cc2)=C[C@@H]1O |
| InChI | InChI=1S/C16H22O5S/c1-4-20-16(21-5-2)11-14(10-15(16)17)22(18,19)13-8-6-12(3)7-9-13/h6-10,15,17H,4-5,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | BARIYUUAIYVXJT-HNNXBMFYSA-N |
| XLogP | 2.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|