C20H24O6S — CID 44597237
[(1R,5S)-8,8-diethoxy-4-oxo-3-bicyclo[3.2.2]nona-2,6-dienyl] 4-methylbenzenesulfonate (PubChem CID 44597237) has the molecular formula C20H24O6S and a molecular weight of 392.47 g/mol. Its IUPAC name is [(1R,5S)-8,8-diethoxy-4-oxo-3-bicyclo[3.2.2]nona-2,6-dienyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,5S)-8,8-diethoxy-4-oxo-3-bicyclo[3.2.2]nona-2,6-dienyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 44597237 |
| Molecular Formula | C20H24O6S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [(1R,5S)-8,8-diethoxy-4-oxo-3-bicyclo[3.2.2]nona-2,6-dienyl] 4-methylbenzenesulfonate |
| SMILES | CCOC1(OCC)C[C@H]2C=C[C@@H]1C=C(OS(=O)(=O)c1ccc(C)cc1)C2=O |
| InChI | InChI=1S/C20H24O6S/c1-4-24-20(25-5-2)13-15-8-9-16(20)12-18(19(15)21)26-27(22,23)17-10-6-14(3)7-11-17/h6-12,15-16H,4-5,13H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | SUONYUTZBNYVDD-HZPDHXFCSA-N |
| XLogP | 3.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|