C39H44O12S4 — CID 15738861
[2,2,6-tris[(4-methylphenyl)sulfonyloxymethyl]spiro[3.3]heptan-6-yl]methyl 4-methylbenzenesulfonate (PubChem CID 15738861) has the molecular formula C39H44O12S4 and a molecular weight of 833.04 g/mol. Its IUPAC name is [2,2,6-tris[(4-methylphenyl)sulfonyloxymethyl]spiro[3.3]heptan-6-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [2,2,6-tris[(4-methylphenyl)sulfonyloxymethyl]spiro[3.3]heptan-6-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15738861 |
| Molecular Formula | C39H44O12S4 |
| Molecular Weight | 833.04 g/mol |
| Exact Mass | 832.17 |
| IUPAC Name | [2,2,6-tris[(4-methylphenyl)sulfonyloxymethyl]spiro[3.3]heptan-6-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(COS(=O)(=O)c3ccc(C)cc3)CC3(C2)CC(COS(=O)(=O)c2ccc(C)cc2)(COS(=O)(=O)c2ccc(C)cc2)C3)cc1 |
| InChI | InChI=1S/C39H44O12S4/c1-29-5-13-33(14-6-29)52(40,41)48-25-38(26-49-53(42,43)34-15-7-30(2)8-16-34)21-37(22-38)23-39(24-37,27-50-54(44,45)35-17-9-31(3)10-18-35)28-51-55(46,47)36-19-11-32(4)12-20-36/h5-20H,21-28H2,1-4H3 |
| InChIKey | SZENQBAAMWLKBG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.04 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|