C24H32O8S2 — CID 90408439
[4,4-dimethoxy-1-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate (PubChem CID 90408439) has the molecular formula C24H32O8S2 and a molecular weight of 512.65 g/mol. Its IUPAC name is [4,4-dimethoxy-1-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [4,4-dimethoxy-1-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90408439 |
| Molecular Formula | C24H32O8S2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | [4,4-dimethoxy-1-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate |
| SMILES | COC1(OC)CCC(COS(=O)(=O)c2ccc(C)cc2)(COS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C24H32O8S2/c1-19-5-9-21(10-6-19)33(25,26)31-17-23(13-15-24(29-3,30-4)16-14-23)18-32-34(27,28)22-11-7-20(2)8-12-22/h5-12H,13-18H2,1-4H3 |
| InChIKey | XJEDEXCUUGSTCJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|