C30H34O9S2 — CID 138585000
methyl 4-[1-hydroxy-4,4-bis[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]benzoate (PubChem CID 138585000) has the molecular formula C30H34O9S2 and a molecular weight of 602.73 g/mol. Its IUPAC name is methyl 4-[1-hydroxy-4,4-bis[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]benzoate.
| Compound Name | methyl 4-[1-hydroxy-4,4-bis[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 138585000 |
| Molecular Formula | C30H34O9S2 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | methyl 4-[1-hydroxy-4,4-bis[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]benzoate |
| SMILES | COC(=O)c1ccc(C2(O)CCC(COS(=O)(=O)c3ccc(C)cc3)(COS(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H34O9S2/c1-22-4-12-26(13-5-22)40(33,34)38-20-29(21-39-41(35,36)27-14-6-23(2)7-15-27)16-18-30(32,19-17-29)25-10-8-24(9-11-25)28(31)37-3/h4-15,32H,16-21H2,1-3H3 |
| InChIKey | KYVCIZADZLVREP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|