C29H34O8S2 — CID 90408498
[4-hydroxy-4-(3-methoxyphenyl)-1-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate (PubChem CID 90408498) has the molecular formula C29H34O8S2 and a molecular weight of 574.72 g/mol. Its IUPAC name is [4-hydroxy-4-(3-methoxyphenyl)-1-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [4-hydroxy-4-(3-methoxyphenyl)-1-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90408498 |
| Molecular Formula | C29H34O8S2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | [4-hydroxy-4-(3-methoxyphenyl)-1-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1cccc(C2(O)CCC(COS(=O)(=O)c3ccc(C)cc3)(COS(=O)(=O)c3ccc(C)cc3)CC2)c1 |
| InChI | InChI=1S/C29H34O8S2/c1-22-7-11-26(12-8-22)38(31,32)36-20-28(21-37-39(33,34)27-13-9-23(2)10-14-27)15-17-29(30,18-16-28)24-5-4-6-25(19-24)35-3/h4-14,19,30H,15-18,20-21H2,1-3H3 |
| InChIKey | YATLZJGCYPFWHO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|