C19H22O3S — CID 14936071
(1-phenylcyclopentyl)methyl 4-methylbenzenesulfonate (PubChem CID 14936071) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is (1-phenylcyclopentyl)methyl 4-methylbenzenesulfonate.
| Compound Name | (1-phenylcyclopentyl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14936071 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (1-phenylcyclopentyl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(c3ccccc3)CCCC2)cc1 |
| InChI | InChI=1S/C19H22O3S/c1-16-9-11-18(12-10-16)23(20,21)22-15-19(13-5-6-14-19)17-7-3-2-4-8-17/h2-4,7-12H,5-6,13-15H2,1H3 |
| InChIKey | JDTRAXFMCVXEJT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|