C21H25NO5S — CID 87064750
(2R)-2-benzyl-2-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylic acid (PubChem CID 87064750) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is (2R)-2-benzyl-2-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylic acid.
| Compound Name | (2R)-2-benzyl-2-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87064750 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (2R)-2-benzyl-2-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@]2(Cc3ccccc3)CCCCN2C(=O)O)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-17-9-11-19(12-10-17)28(25,26)27-16-21(15-18-7-3-2-4-8-18)13-5-6-14-22(21)20(23)24/h2-4,7-12H,5-6,13-16H2,1H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | BUOMDEWVZYEUNX-OAQYLSRUSA-N |
| XLogP | 3.85 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|