C24H30O7S2 — CID 165353107
[1-[(4-methylphenyl)sulfonyloxymethyl]-2-oxocyclooctyl]methyl 4-methylbenzenesulfonate (PubChem CID 165353107) has the molecular formula C24H30O7S2 and a molecular weight of 494.63 g/mol. Its IUPAC name is [1-[(4-methylphenyl)sulfonyloxymethyl]-2-oxocyclooctyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [1-[(4-methylphenyl)sulfonyloxymethyl]-2-oxocyclooctyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 165353107 |
| Molecular Formula | C24H30O7S2 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [1-[(4-methylphenyl)sulfonyloxymethyl]-2-oxocyclooctyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(COS(=O)(=O)c3ccc(C)cc3)CCCCCCC2=O)cc1 |
| InChI | InChI=1S/C24H30O7S2/c1-19-8-12-21(13-9-19)32(26,27)30-17-24(16-6-4-3-5-7-23(24)25)18-31-33(28,29)22-14-10-20(2)11-15-22/h8-15H,3-7,16-18H2,1-2H3 |
| InChIKey | GEUSXFRFBBVODA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|