C16H20F3NO4S — CID 100946582
[1-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]methyl 4-methylbenzenesulfonate (PubChem CID 100946582) has the molecular formula C16H20F3NO4S and a molecular weight of 379.40 g/mol. Its IUPAC name is [1-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [1-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 100946582 |
| Molecular Formula | C16H20F3NO4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [1-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(NC(=O)C(F)(F)F)CCCCC2)cc1 |
| InChI | InChI=1S/C16H20F3NO4S/c1-12-5-7-13(8-6-12)25(22,23)24-11-15(9-3-2-4-10-15)20-14(21)16(17,18)19/h5-8H,2-4,9-11H2,1H3,(H,20,21) |
| InChIKey | GTHXFEFKACAHGL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|