C19H28F2O6S — CID 157477920
(4-fluorooxan-4-yl)methanol;(4-fluorooxan-4-yl)methyl 4-methylbenzenesulfonate (PubChem CID 157477920) has the molecular formula C19H28F2O6S and a molecular weight of 422.49 g/mol. Its IUPAC name is (4-fluorooxan-4-yl)methanol;(4-fluorooxan-4-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (4-fluorooxan-4-yl)methanol;(4-fluorooxan-4-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 157477920 |
| Molecular Formula | C19H28F2O6S |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (4-fluorooxan-4-yl)methanol;(4-fluorooxan-4-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(F)CCOCC2)cc1.OCC1(F)CCOCC1 |
| InChI | InChI=1S/C13H17FO4S.C6H11FO2/c1-11-2-4-12(5-3-11)19(15,16)18-10-13(14)6-8-17-9-7-13;7-6(5-8)1-3-9-4-2-6/h2-5H,6-10H2,1H3;8H,1-5H2 |
| InChIKey | BVUUYDOPIIBDPU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|