C27H42O6S — CID 159485070
(4-but-3-enyloxan-4-yl)methanol;(4-but-3-enyloxan-4-yl)methyl 4-methylbenzenesulfonate (PubChem CID 159485070) has the molecular formula C27H42O6S and a molecular weight of 494.69 g/mol. Its IUPAC name is (4-but-3-enyloxan-4-yl)methanol;(4-but-3-enyloxan-4-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (4-but-3-enyloxan-4-yl)methanol;(4-but-3-enyloxan-4-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159485070 |
| Molecular Formula | C27H42O6S |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (4-but-3-enyloxan-4-yl)methanol;(4-but-3-enyloxan-4-yl)methyl 4-methylbenzenesulfonate |
| SMILES | C=CCCC1(CO)CCOCC1.C=CCCC1(COS(=O)(=O)c2ccc(C)cc2)CCOCC1 |
| InChI | InChI=1S/C17H24O4S.C10H18O2/c1-3-4-9-17(10-12-20-13-11-17)14-21-22(18,19)16-7-5-15(2)6-8-16;1-2-3-4-10(9-11)5-7-12-8-6-10/h3,5-8H,1,4,9-14H2,2H3;2,11H,1,3-9H2 |
| InChIKey | LXMAMLPKQDDZKV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|