C13H18O4S — CID 125470094
[1-(2-hydroxyethyl)cyclobutyl] 4-methylbenzenesulfonate (PubChem CID 125470094) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is [1-(2-hydroxyethyl)cyclobutyl] 4-methylbenzenesulfonate.
| Compound Name | [1-(2-hydroxyethyl)cyclobutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 125470094 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | [1-(2-hydroxyethyl)cyclobutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2(CCO)CCC2)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-11-3-5-12(6-4-11)18(15,16)17-13(9-10-14)7-2-8-13/h3-6,14H,2,7-10H2,1H3 |
| InChIKey | PGRALKNOTJRXKE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|