About methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate
methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate (PubChem CID 21392681) has the molecular formula C17H26O4S
and a molecular weight of 326.46 g/mol. Its IUPAC name is methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate |
| PubChem CID | 21392681 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate |
| SMILES | CO.Cc1ccc(S(=O)(=O)OC23CCC(C)(CC2)CC3)cc1 |
| InChI | InChI=1S/C16H22O3S.CH4O/c1-13-3-5-14(6-4-13)20(17,18)19-16-10-7-15(2,8-11-16)9-12-16;1-2/h3-6H,7-12H2,1-2H3;2H,1H3 |
| InChIKey | CIMVXDWILHRNLA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate?
The IUPAC name of methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate (CID 21392681) is methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate.
What is the SMILES notation for methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate?
The canonical SMILES for methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate is CO.Cc1ccc(S(=O)(=O)OC23CCC(C)(CC2)CC3)cc1.
What is the InChIKey of methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate?
The InChIKey is CIMVXDWILHRNLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3S.CH4O/c1-13-3-5-14(6-4-13)20(17,18)19-16-10-7-15(2,8-11-16)9-12-16;1-2/h3-6H,7-12H2,1-2H3;2H,1H3.
What are the key properties of methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate?
methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate has a molecular weight of 326.46 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(4-methyl-1-bicyclo[2.2.2]octanyl) 4-methylbenzenesulfonate is sourced from PubChem (CID 21392681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).