C13H7F11O3S — CID 87625142
(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 4-methylbenzenesulfonate (PubChem CID 87625142) has the molecular formula C13H7F11O3S and a molecular weight of 452.24 g/mol. Its IUPAC name is (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 4-methylbenzenesulfonate.
| Compound Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87625142 |
| Molecular Formula | C13H7F11O3S |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C13H7F11O3S/c1-6-2-4-7(5-3-6)28(25,26)27-13(24)11(20,21)9(16,17)8(14,15)10(18,19)12(13,22)23/h2-5H,1H3 |
| InChIKey | LNGDFNATHGWADF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|