(2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate

C11H12F2O3S — CID 86732597

IUPAC(2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate
SMILESCc1ccc(S(=O)(=O)OCC2CC2(F)F)cc1
InChIInChI=1S/C11H12F2O3S/c1-8-2-4-10(5-3-8)17(14,15)16-7-9-6-11(9,12)13/h2-5,9H,6-7H2,1H3
InChIKeyZAIMLHQVHLANIA-UHFFFAOYSA-N
MW262.28 g/mol
LogP2.36
Rot. Bonds4

About (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate

(2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate (PubChem CID 86732597) has the molecular formula C11H12F2O3S and a molecular weight of 262.28 g/mol. Its IUPAC name is (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate.

Molecular Properties

Compound Name(2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate
PubChem CID86732597
Molecular FormulaC11H12F2O3S
Molecular Weight262.28 g/mol
Exact Mass262.05
IUPAC Name(2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate
SMILESCc1ccc(S(=O)(=O)OCC2CC2(F)F)cc1
InChIInChI=1S/C11H12F2O3S/c1-8-2-4-10(5-3-8)17(14,15)16-7-9-6-11(9,12)13/h2-5,9H,6-7H2,1H3
InChIKeyZAIMLHQVHLANIA-UHFFFAOYSA-N
XLogP2.36
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.28
LogP ≤ 52.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate?
The IUPAC name of (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate (CID 86732597) is (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate.
What is the SMILES notation for (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate?
The canonical SMILES for (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2CC2(F)F)cc1.
What is the InChIKey of (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate?
The InChIKey is ZAIMLHQVHLANIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O3S/c1-8-2-4-10(5-3-8)17(14,15)16-7-9-6-11(9,12)13/h2-5,9H,6-7H2,1H3.
What are the key properties of (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate?
(2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate has a molecular weight of 262.28 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 86732597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).