C11H12F2O3S — CID 86732597
(2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate (PubChem CID 86732597) has the molecular formula C11H12F2O3S and a molecular weight of 262.28 g/mol. Its IUPAC name is (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate.
| Compound Name | (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86732597 |
| Molecular Formula | C11H12F2O3S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | (2,2-difluorocyclopropyl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC2(F)F)cc1 |
| InChI | InChI=1S/C11H12F2O3S/c1-8-2-4-10(5-3-8)17(14,15)16-7-9-6-11(9,12)13/h2-5,9H,6-7H2,1H3 |
| InChIKey | ZAIMLHQVHLANIA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|