C14H15FO3S — CID 174330496
[(1R)-3-fluorocyclohexa-2,4-dien-1-yl]methyl 4-methylbenzenesulfonate (PubChem CID 174330496) has the molecular formula C14H15FO3S and a molecular weight of 282.34 g/mol. Its IUPAC name is [(1R)-3-fluorocyclohexa-2,4-dien-1-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R)-3-fluorocyclohexa-2,4-dien-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 174330496 |
| Molecular Formula | C14H15FO3S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [(1R)-3-fluorocyclohexa-2,4-dien-1-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2C=C(F)C=CC2)cc1 |
| InChI | InChI=1S/C14H15FO3S/c1-11-5-7-14(8-6-11)19(16,17)18-10-12-3-2-4-13(15)9-12/h2,4-9,12H,3,10H2,1H3/t12-/m1/s1 |
| InChIKey | QNXUJSTUAFEGQH-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|