C16H18O3S — CID 22090857
(2,6-dimethylidenecyclohex-3-en-1-yl)methyl 4-methylbenzenesulfonate (PubChem CID 22090857) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is (2,6-dimethylidenecyclohex-3-en-1-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (2,6-dimethylidenecyclohex-3-en-1-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22090857 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (2,6-dimethylidenecyclohex-3-en-1-yl)methyl 4-methylbenzenesulfonate |
| SMILES | C=C1C=CCC(=C)C1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H18O3S/c1-12-7-9-15(10-8-12)20(17,18)19-11-16-13(2)5-4-6-14(16)3/h4-5,7-10,16H,2-3,6,11H2,1H3 |
| InChIKey | LUSQZEASEZBPND-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|