C14H16O3S — CID 174450649
cyclohexa-2,4-dien-1-ylmethyl 4-methylbenzenesulfonate (PubChem CID 174450649) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylmethyl 4-methylbenzenesulfonate.
| Compound Name | cyclohexa-2,4-dien-1-ylmethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 174450649 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylmethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2C=CC=CC2)cc1 |
| InChI | InChI=1S/C14H16O3S/c1-12-7-9-14(10-8-12)18(15,16)17-11-13-5-3-2-4-6-13/h2-5,7-10,13H,6,11H2,1H3 |
| InChIKey | MVNHNFWKXOYQJK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|