C28H30O6S2 — CID 98557760
[(1R,4R,5R,6R,7S,8S,9S,10R)-6-[(4-methylphenyl)sulfonyloxymethyl]-5-pentacyclo[6.4.0.02,10.03,7.04,9]dodec-11-enyl]methyl 4-methylbenzenesulfonate (PubChem CID 98557760) has the molecular formula C28H30O6S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is [(1R,4R,5R,6R,7S,8S,9S,10R)-6-[(4-methylphenyl)sulfonyloxymethyl]-5-pentacyclo[6.4.0.02,10.03,7.04,9]dodec-11-enyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,4R,5R,6R,7S,8S,9S,10R)-6-[(4-methylphenyl)sulfonyloxymethyl]-5-pentacyclo[6.4.0.02,10.03,7.04,9]dodec-11-enyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 98557760 |
| Molecular Formula | C28H30O6S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [(1R,4R,5R,6R,7S,8S,9S,10R)-6-[(4-methylphenyl)sulfonyloxymethyl]-5-pentacyclo[6.4.0.02,10.03,7.04,9]dodec-11-enyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2[C@H](COS(=O)(=O)c3ccc(C)cc3)[C@@H]3C4C5[C@H]6C=C[C@H]5[C@H]3[C@H]6[C@H]42)cc1 |
| InChI | InChI=1S/C28H30O6S2/c1-15-3-7-17(8-4-15)35(29,30)33-13-21-22(14-34-36(31,32)18-9-5-16(2)6-10-18)27-25-20-12-11-19-23(20)28(27)26(21)24(19)25/h3-12,19-28H,13-14H2,1-2H3/t19-,20-,21+,22+,23?,24+,25+,26-,27+,28?/m1/s1 |
| InChIKey | CJGTVVIGBLZSFQ-VMDLQPOSSA-N |
| XLogP | 4.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|