C30H32O6S2 — CID 12536934
[(4R,9S)-9-(4-methylphenyl)sulfonyloxy-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl] 4-methylbenzenesulfonate (PubChem CID 12536934) has the molecular formula C30H32O6S2 and a molecular weight of 552.71 g/mol. Its IUPAC name is [(4R,9S)-9-(4-methylphenyl)sulfonyloxy-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(4R,9S)-9-(4-methylphenyl)sulfonyloxy-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12536934 |
| Molecular Formula | C30H32O6S2 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | [(4R,9S)-9-(4-methylphenyl)sulfonyloxy-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CC3C4CC(OS(=O)(=O)c5ccc(C)cc5)C5C6C=CC7C2C3C(C76)C45)cc1 |
| InChI | InChI=1S/C30H32O6S2/c1-15-3-7-17(8-4-15)37(31,32)35-23-13-21-22-14-24(36-38(33,34)18-9-5-16(2)6-10-18)27-20-12-11-19-25(20)30(29(22)27)28(21)26(19)23/h3-12,19-30H,13-14H2,1-2H3 |
| InChIKey | OZTVMUNEZMSQQH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|