C15H20O4S — CID 11887721
[(1R,2S,4S,6R)-6-methoxy-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate (PubChem CID 11887721) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is [(1R,2S,4S,6R)-6-methoxy-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,4S,6R)-6-methoxy-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11887721 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [(1R,2S,4S,6R)-6-methoxy-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1C[C@@H]2C[C@H]1[C@@H](OS(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C15H20O4S/c1-10-3-5-12(6-4-10)20(16,17)19-15-9-11-7-13(15)14(8-11)18-2/h3-6,11,13-15H,7-9H2,1-2H3/t11-,13+,14+,15-/m0/s1 |
| InChIKey | YEYBRTMMOJKDHE-MYPMTAMASA-N |
| XLogP | 2.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|