C14H17NO5S — CID 11890263
[(1R,2S,4S,6R)-6-nitro-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate (PubChem CID 11890263) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is [(1R,2S,4S,6R)-6-nitro-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,4S,6R)-6-nitro-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11890263 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [(1R,2S,4S,6R)-6-nitro-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C[C@H]3C[C@@H]2[C@H]([N+](=O)[O-])C3)cc1 |
| InChI | InChI=1S/C14H17NO5S/c1-9-2-4-11(5-3-9)21(18,19)20-14-8-10-6-12(14)13(7-10)15(16)17/h2-5,10,12-14H,6-8H2,1H3/t10-,12+,13+,14-/m0/s1 |
| InChIKey | DBUTUPHCSIRUQR-ASEORRQLSA-N |
| XLogP | 2.14 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|